C13H10Cl3N3O — CID 107337386
2-(5-amino-2-pyridinyl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 107337386) has the molecular formula C13H10Cl3N3O and a molecular weight of 330.60 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 107337386 |
| Molecular Formula | C13H10Cl3N3O |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Nc1ccc(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C13H10Cl3N3O/c14-9-4-11(16)12(5-10(9)15)19-13(20)3-8-2-1-7(17)6-18-8/h1-2,4-6H,3,17H2,(H,19,20) |
| InChIKey | WTZDRWQCRBJQFJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|