C15H17N3O — CID 107337469
2-(5-amino-2-pyridinyl)-N-(2,6-dimethylphenyl)acetamide (PubChem CID 107337469) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 107337469 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)Cc1ccc(N)cn1 |
| InChI | InChI=1S/C15H17N3O/c1-10-4-3-5-11(2)15(10)18-14(19)8-13-7-6-12(16)9-17-13/h3-7,9H,8,16H2,1-2H3,(H,18,19) |
| InChIKey | REPKUORXYIAQSK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |