C16H19N3O2 — CID 107338030
2-(5-amino-2-pyridinyl)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 107338030) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 107338030 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(C(=O)Cc2ccc(N)cn2)C2CC2)o1 |
| InChI | InChI=1S/C16H19N3O2/c1-11-2-7-15(21-11)10-19(14-5-6-14)16(20)8-13-4-3-12(17)9-18-13/h2-4,7,9,14H,5-6,8,10,17H2,1H3 |
| InChIKey | XCJKHDRWVWAZQA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |