2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid

C16H16N2O3 — CID 107338774

IUPAC2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid
SMILESCc1ccc(C(=O)Nc2ccc(CC(=O)O)nc2)c(C)c1
InChIInChI=1S/C16H16N2O3/c1-10-3-6-14(11(2)7-10)16(21)18-13-5-4-12(17-9-13)8-15(19)20/h3-7,9H,8H2,1-2H3,(H,18,21)(H,19,20)
InChIKeyVQYFCISBIQXNOV-UHFFFAOYSA-N
MW284.32 g/mol
LogP2.58
Rot. Bonds4

About 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid

2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid (PubChem CID 107338774) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid.

Molecular Properties

Compound Name2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid
PubChem CID107338774
Molecular FormulaC16H16N2O3
Molecular Weight284.32 g/mol
Exact Mass284.12
IUPAC Name2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid
SMILESCc1ccc(C(=O)Nc2ccc(CC(=O)O)nc2)c(C)c1
InChIInChI=1S/C16H16N2O3/c1-10-3-6-14(11(2)7-10)16(21)18-13-5-4-12(17-9-13)8-15(19)20/h3-7,9H,8H2,1-2H3,(H,18,21)(H,19,20)
InChIKeyVQYFCISBIQXNOV-UHFFFAOYSA-N
XLogP2.58
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.32
LogP ≤ 52.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid?
The IUPAC name of 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid (CID 107338774) is 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid.
What is the SMILES notation for 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid?
The canonical SMILES for 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid is Cc1ccc(C(=O)Nc2ccc(CC(=O)O)nc2)c(C)c1.
What is the InChIKey of 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid?
The InChIKey is VQYFCISBIQXNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-10-3-6-14(11(2)7-10)16(21)18-13-5-4-12(17-9-13)8-15(19)20/h3-7,9H,8H2,1-2H3,(H,18,21)(H,19,20).
What are the key properties of 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid?
2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid has a molecular weight of 284.32 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(2,4-dimethylbenzoyl)amino]-2-pyridinyl]acetic acid is sourced from PubChem (CID 107338774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).