C16H24N2O3 — CID 107338804
2-[5-(3,5,5-trimethylhexanoylamino)-2-pyridinyl]acetic acid (PubChem CID 107338804) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[5-(3,5,5-trimethylhexanoylamino)-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-(3,5,5-trimethylhexanoylamino)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 107338804 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-[5-(3,5,5-trimethylhexanoylamino)-2-pyridinyl]acetic acid |
| SMILES | CC(CC(=O)Nc1ccc(CC(=O)O)nc1)CC(C)(C)C |
| InChI | InChI=1S/C16H24N2O3/c1-11(9-16(2,3)4)7-14(19)18-13-6-5-12(17-10-13)8-15(20)21/h5-6,10-11H,7-9H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | GTRHHYUEFDDNFL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |