C8H8N2O3 — CID 107339372
2-(5-formamido-2-pyridinyl)acetic acid (PubChem CID 107339372) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-(5-formamido-2-pyridinyl)acetic acid.
| Compound Name | 2-(5-formamido-2-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 107339372 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-(5-formamido-2-pyridinyl)acetic acid |
| SMILES | O=CNc1ccc(CC(=O)O)nc1 |
| InChI | InChI=1S/C8H8N2O3/c11-5-10-7-2-1-6(9-4-7)3-8(12)13/h1-2,4-5H,3H2,(H,10,11)(H,12,13) |
| InChIKey | NWVOONBTFCJVNA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|