C11H9BrN2O4S2 — CID 107339698
2-[5-[(5-bromothiophen-2-yl)sulfonylamino]-2-pyridinyl]acetic acid (PubChem CID 107339698) has the molecular formula C11H9BrN2O4S2 and a molecular weight of 377.24 g/mol. Its IUPAC name is 2-[5-[(5-bromothiophen-2-yl)sulfonylamino]-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-[(5-bromothiophen-2-yl)sulfonylamino]-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 107339698 |
| Molecular Formula | C11H9BrN2O4S2 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | 2-[5-[(5-bromothiophen-2-yl)sulfonylamino]-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NS(=O)(=O)c2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C11H9BrN2O4S2/c12-9-3-4-11(19-9)20(17,18)14-8-2-1-7(13-6-8)5-10(15)16/h1-4,6,14H,5H2,(H,15,16) |
| InChIKey | XFNRMEDSTNTKKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |