C12H16N4O — CID 107339707
2-(5-amino-2-pyridinyl)-N-(2-cyano-2-methylpropyl)acetamide (PubChem CID 107339707) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(2-cyano-2-methylpropyl)acetamide.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(2-cyano-2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 107339707 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(2-cyano-2-methylpropyl)acetamide |
| SMILES | CC(C)(C#N)CNC(=O)Cc1ccc(N)cn1 |
| InChI | InChI=1S/C12H16N4O/c1-12(2,7-13)8-16-11(17)5-10-4-3-9(14)6-15-10/h3-4,6H,5,8,14H2,1-2H3,(H,16,17) |
| InChIKey | CWYKTJXFHVNULX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |