C19H23NOS — CID 10733987
2,4,6,7-tetramethyl-2-(phenylsulfanylmethyl)-3H-1-benzofuran-5-amine (PubChem CID 10733987) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 2,4,6,7-tetramethyl-2-(phenylsulfanylmethyl)-3H-1-benzofuran-5-amine.
| Compound Name | 2,4,6,7-tetramethyl-2-(phenylsulfanylmethyl)-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10733987 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2,4,6,7-tetramethyl-2-(phenylsulfanylmethyl)-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CSc1ccccc1)O2 |
| InChI | InChI=1S/C19H23NOS/c1-12-13(2)18-16(14(3)17(12)20)10-19(4,21-18)11-22-15-8-6-5-7-9-15/h5-9H,10-11,20H2,1-4H3 |
| InChIKey | JIVJQOIRHLYLOY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|