About 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine
6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine (PubChem CID 107340112) has the molecular formula C12H19N3S
and a molecular weight of 237.37 g/mol. Its IUPAC name is 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine |
| PubChem CID | 107340112 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine |
| SMILES | Nc1ccc(CCN2CCCSCC2)nc1 |
| InChI | InChI=1S/C12H19N3S/c13-11-2-3-12(14-10-11)4-6-15-5-1-8-16-9-7-15/h2-3,10H,1,4-9,13H2 |
| InChIKey | PLBPPEWZXDPOSP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine?
The IUPAC name of 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine (CID 107340112) is 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine.
What is the SMILES notation for 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine?
The canonical SMILES for 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine is Nc1ccc(CCN2CCCSCC2)nc1.
What is the InChIKey of 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine?
The InChIKey is PLBPPEWZXDPOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3S/c13-11-2-3-12(14-10-11)4-6-15-5-1-8-16-9-7-15/h2-3,10H,1,4-9,13H2.
What are the key properties of 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine?
6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine has a molecular weight of 237.37 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(1,4-thiazepan-4-yl)ethyl]pyridin-3-amine is sourced from PubChem (CID 107340112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).