C13H17NO5 — CID 107341870
3-(3-amino-2-methoxycarbonylphenoxy)-2,2-dimethylpropanoic acid (PubChem CID 107341870) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-(3-amino-2-methoxycarbonylphenoxy)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3-amino-2-methoxycarbonylphenoxy)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 107341870 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-(3-amino-2-methoxycarbonylphenoxy)-2,2-dimethylpropanoic acid |
| SMILES | COC(=O)c1c(N)cccc1OCC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H17NO5/c1-13(2,12(16)17)7-19-9-6-4-5-8(14)10(9)11(15)18-3/h4-6H,7,14H2,1-3H3,(H,16,17) |
| InChIKey | ALSBPCQLJWHMSL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|