2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid

C12H6Cl2N2O5 — CID 107342080

IUPAC2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid
SMILESO=C(O)c1c(Oc2ncc(Cl)cc2Cl)cccc1[N+](=O)[O-]
InChIInChI=1S/C12H6Cl2N2O5/c13-6-4-7(14)11(15-5-6)21-9-3-1-2-8(16(19)20)10(9)12(17)18/h1-5H,(H,17,18)
InChIKeyIWZZWZVWWVDXOO-UHFFFAOYSA-N
MW329.10 g/mol
LogP3.79
Rot. Bonds4

About 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid

2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid (PubChem CID 107342080) has the molecular formula C12H6Cl2N2O5 and a molecular weight of 329.10 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid.

Molecular Properties

Compound Name2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid
PubChem CID107342080
Molecular FormulaC12H6Cl2N2O5
Molecular Weight329.10 g/mol
Exact Mass327.97
IUPAC Name2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid
SMILESO=C(O)c1c(Oc2ncc(Cl)cc2Cl)cccc1[N+](=O)[O-]
InChIInChI=1S/C12H6Cl2N2O5/c13-6-4-7(14)11(15-5-6)21-9-3-1-2-8(16(19)20)10(9)12(17)18/h1-5H,(H,17,18)
InChIKeyIWZZWZVWWVDXOO-UHFFFAOYSA-N
XLogP3.79
TPSA102.56 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.10
LogP ≤ 53.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid?
The IUPAC name of 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid (CID 107342080) is 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid.
What is the SMILES notation for 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid?
The canonical SMILES for 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid is O=C(O)c1c(Oc2ncc(Cl)cc2Cl)cccc1[N+](=O)[O-].
What is the InChIKey of 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid?
The InChIKey is IWZZWZVWWVDXOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2N2O5/c13-6-4-7(14)11(15-5-6)21-9-3-1-2-8(16(19)20)10(9)12(17)18/h1-5H,(H,17,18).
What are the key properties of 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid?
2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid has a molecular weight of 329.10 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dichloro-2-pyridinyl)oxy]-6-nitrobenzoic acid is sourced from PubChem (CID 107342080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).