About [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate
[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate (PubChem CID 10734223) has the molecular formula C17H36O3Si
and a molecular weight of 316.56 g/mol. Its IUPAC name is [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate |
| PubChem CID | 10734223 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-11-14(20-21(9,10)17(6,7)8)13(2)12-19-15(18)16(3,4)5/h13-14H,11-12H2,1-10H3/t13-,14+/m1/s1 |
| InChIKey | ZGGDEOVVIAOVCF-KGLIPLIRSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate?
The IUPAC name of [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate (CID 10734223) is [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate is CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)COC(=O)C(C)(C)C.
What is the InChIKey of [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate?
The InChIKey is ZGGDEOVVIAOVCF-KGLIPLIRSA-N. The full InChI is InChI=1S/C17H36O3Si/c1-11-14(20-21(9,10)17(6,7)8)13(2)12-19-15(18)16(3,4)5/h13-14H,11-12H2,1-10H3/t13-,14+/m1/s1.
What are the key properties of [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate?
[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate has a molecular weight of 316.56 g/mol, XLogP of 5.01, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 10734223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).