C15H23N3O2S — CID 107342600
6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2,2-dimethylhexan-1-amine (PubChem CID 107342600) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is 6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2,2-dimethylhexan-1-amine.
| Compound Name | 6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2,2-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 107342600 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCN1C=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H23N3O2S/c1-15(2,11-16)9-5-6-10-18-12-17-21(19,20)14-8-4-3-7-13(14)18/h3-4,7-8,12H,5-6,9-11,16H2,1-2H3 |
| InChIKey | IHCCISMJPBZWAW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|