C12H12N2O4S — CID 107342640
(Z)-4-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2-methylbut-2-enoic acid (PubChem CID 107342640) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is (Z)-4-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2-methylbut-2-enoic acid.
| Compound Name | (Z)-4-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 107342640 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (Z)-4-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)-2-methylbut-2-enoic acid |
| SMILES | C/C(=C/CN1C=NS(=O)(=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C12H12N2O4S/c1-9(12(15)16)6-7-14-8-13-19(17,18)11-5-3-2-4-10(11)14/h2-6,8H,7H2,1H3,(H,15,16)/b9-6- |
| InChIKey | YXGQZIVXFAYXRT-TWGQIWQCSA-N |
| XLogP | 1.25 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|