C14H17BrN2O3S — CID 107342660
4-[[4-(bromomethyl)oxan-4-yl]methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 107342660) has the molecular formula C14H17BrN2O3S and a molecular weight of 373.27 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)oxan-4-yl]methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 4-[[4-(bromomethyl)oxan-4-yl]methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 107342660 |
| Molecular Formula | C14H17BrN2O3S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 4-[[4-(bromomethyl)oxan-4-yl]methyl]-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=S1(=O)N=CN(CC2(CBr)CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C14H17BrN2O3S/c15-9-14(5-7-20-8-6-14)10-17-11-16-21(18,19)13-4-2-1-3-12(13)17/h1-4,11H,5-10H2 |
| InChIKey | QGBOAPOQFVYEHF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|