C19H27NO3 — CID 10734277
butyl (3R,3aS,7aS)-2-benzyl-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzoxazole-3-carboxylate (PubChem CID 10734277) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is butyl (3R,3aS,7aS)-2-benzyl-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzoxazole-3-carboxylate.
| Compound Name | butyl (3R,3aS,7aS)-2-benzyl-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 10734277 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | butyl (3R,3aS,7aS)-2-benzyl-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzoxazole-3-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1[C@@H]2CCCC[C@@H]2ON1Cc1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-2-3-13-22-19(21)18-16-11-7-8-12-17(16)23-20(18)14-15-9-5-4-6-10-15/h4-6,9-10,16-18H,2-3,7-8,11-14H2,1H3/t16-,17+,18-/m1/s1 |
| InChIKey | BEJDACHNKLHXKZ-FGTMMUONSA-N |
| XLogP | 3.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|