C10H10N6O2S2 — CID 107342830
[4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]thiadiazol-5-yl]hydrazine (PubChem CID 107342830) has the molecular formula C10H10N6O2S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is [4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]thiadiazol-5-yl]hydrazine.
| Compound Name | [4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]thiadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 107342830 |
| Molecular Formula | C10H10N6O2S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]thiadiazol-5-yl]hydrazine |
| SMILES | NNc1snnc1CN1C=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C10H10N6O2S2/c11-13-10-7(14-15-19-10)5-16-6-12-20(17,18)9-4-2-1-3-8(9)16/h1-4,6,13H,5,11H2 |
| InChIKey | YCUXJXQGXAOBFP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|