C12H16N2O2S2 — CID 107342912
5-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)pentane-1-thiol (PubChem CID 107342912) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 5-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)pentane-1-thiol.
| Compound Name | 5-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)pentane-1-thiol |
|---|---|
| PubChem CID | 107342912 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)pentane-1-thiol |
| SMILES | O=S1(=O)N=CN(CCCCCS)c2ccccc21 |
| InChI | InChI=1S/C12H16N2O2S2/c15-18(16)12-7-3-2-6-11(12)14(10-13-18)8-4-1-5-9-17/h2-3,6-7,10,17H,1,4-5,8-9H2 |
| InChIKey | SRJUCUORCQTYMD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|