C11H14N2O2S — CID 107342929
2-oxo-N-(thiolan-3-ylmethyl)-1H-pyridine-4-carboxamide (PubChem CID 107342929) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-oxo-N-(thiolan-3-ylmethyl)-1H-pyridine-4-carboxamide.
| Compound Name | 2-oxo-N-(thiolan-3-ylmethyl)-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107342929 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-oxo-N-(thiolan-3-ylmethyl)-1H-pyridine-4-carboxamide |
| SMILES | O=C(NCC1CCSC1)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C11H14N2O2S/c14-10-5-9(1-3-12-10)11(15)13-6-8-2-4-16-7-8/h1,3,5,8H,2,4,6-7H2,(H,12,14)(H,13,15) |
| InChIKey | BIFQPAASAKVXGB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |