C21H18O3 — CID 10734320
(2S,8R)-2-phenyl-3,7,18-trioxatetracyclo[7.7.1.12,8.013,17]octadeca-1(16),9,11,13(17),14-pentaene (PubChem CID 10734320) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2S,8R)-2-phenyl-3,7,18-trioxatetracyclo[7.7.1.12,8.013,17]octadeca-1(16),9,11,13(17),14-pentaene.
| Compound Name | (2S,8R)-2-phenyl-3,7,18-trioxatetracyclo[7.7.1.12,8.013,17]octadeca-1(16),9,11,13(17),14-pentaene |
|---|---|
| PubChem CID | 10734320 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2S,8R)-2-phenyl-3,7,18-trioxatetracyclo[7.7.1.12,8.013,17]octadeca-1(16),9,11,13(17),14-pentaene |
| SMILES | c1ccc([C@]23OCCCO[C@H](O2)c2cccc4cccc3c24)cc1 |
| InChI | InChI=1S/C21H18O3/c1-2-9-16(10-3-1)21-18-12-5-8-15-7-4-11-17(19(15)18)20(24-21)22-13-6-14-23-21/h1-5,7-12,20H,6,13-14H2/t20-,21+/m1/s1 |
| InChIKey | KCKIMMRHEYVMIS-RTWAWAEBSA-N |
| XLogP | 4.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |