About 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine
2-(3-amino-2,4-difluorophenyl)sulfonylguanidine (PubChem CID 107343914) has the molecular formula C7H8F2N4O2S
and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine.
Molecular Properties
| Compound Name | 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine |
| PubChem CID | 107343914 |
| Molecular Formula | C7H8F2N4O2S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C7H8F2N4O2S/c8-3-1-2-4(5(9)6(3)10)16(14,15)13-7(11)12/h1-2H,10H2,(H4,11,12,13) |
| InChIKey | UVOFOIHQPUGZOF-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine?
The IUPAC name of 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine (CID 107343914) is 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine.
What is the SMILES notation for 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine?
The canonical SMILES for 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine is NC(N)=NS(=O)(=O)c1ccc(F)c(N)c1F.
What is the InChIKey of 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine?
The InChIKey is UVOFOIHQPUGZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N4O2S/c8-3-1-2-4(5(9)6(3)10)16(14,15)13-7(11)12/h1-2H,10H2,(H4,11,12,13).
What are the key properties of 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine?
2-(3-amino-2,4-difluorophenyl)sulfonylguanidine has a molecular weight of 250.23 g/mol, XLogP of -0.49, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-2,4-difluorophenyl)sulfonylguanidine is sourced from PubChem (CID 107343914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).