About N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 10734431) has the molecular formula C12H11F3N2O3S
and a molecular weight of 320.29 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 10734431 |
| Molecular Formula | C12H11F3N2O3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccccc2C(F)(F)F)c1C |
| InChI | InChI=1S/C12H11F3N2O3S/c1-7-8(2)16-20-11(7)17-21(18,19)10-6-4-3-5-9(10)12(13,14)15/h3-6,17H,1-2H3 |
| InChIKey | YWMJIHYZSISDHK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide (CID 10734431) is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide is Cc1noc(NS(=O)(=O)c2ccccc2C(F)(F)F)c1C.
What is the InChIKey of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide?
The InChIKey is YWMJIHYZSISDHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2O3S/c1-7-8(2)16-20-11(7)17-21(18,19)10-6-4-3-5-9(10)12(13,14)15/h3-6,17H,1-2H3.
What are the key properties of N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide?
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide has a molecular weight of 320.29 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 10734431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).