C7H10N4O3 — CID 107344544
methyl 4-amino-1-(2-amino-2-oxoethyl)pyrazole-3-carboxylate (PubChem CID 107344544) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 4-amino-1-(2-amino-2-oxoethyl)pyrazole-3-carboxylate.
| Compound Name | methyl 4-amino-1-(2-amino-2-oxoethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 107344544 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | methyl 4-amino-1-(2-amino-2-oxoethyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(CC(N)=O)cc1N |
| InChI | InChI=1S/C7H10N4O3/c1-14-7(13)6-4(8)2-11(10-6)3-5(9)12/h2H,3,8H2,1H3,(H2,9,12) |
| InChIKey | ZXOZZAHJCJOXQG-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |