C12H20N4O3 — CID 107345027
ethyl 4-amino-1-[2-(butylamino)-2-oxoethyl]pyrazole-3-carboxylate (PubChem CID 107345027) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is ethyl 4-amino-1-[2-(butylamino)-2-oxoethyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 4-amino-1-[2-(butylamino)-2-oxoethyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 107345027 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | ethyl 4-amino-1-[2-(butylamino)-2-oxoethyl]pyrazole-3-carboxylate |
| SMILES | CCCCNC(=O)Cn1cc(N)c(C(=O)OCC)n1 |
| InChI | InChI=1S/C12H20N4O3/c1-3-5-6-14-10(17)8-16-7-9(13)11(15-16)12(18)19-4-2/h7H,3-6,8,13H2,1-2H3,(H,14,17) |
| InChIKey | CAVVBRVPNVGYEH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|