About 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide
4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide (PubChem CID 107345100) has the molecular formula C6H8F2N4O
and a molecular weight of 190.15 g/mol. Its IUPAC name is 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide |
| PubChem CID | 107345100 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(F)F)cc1N |
| InChI | InChI=1S/C6H8F2N4O/c7-4(8)2-12-1-3(9)5(11-12)6(10)13/h1,4H,2,9H2,(H2,10,13) |
| InChIKey | WBWDKDUFPGEVTG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide?
The IUPAC name of 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide (CID 107345100) is 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide.
What is the SMILES notation for 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide?
The canonical SMILES for 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide is NC(=O)c1nn(CC(F)F)cc1N.
What is the InChIKey of 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide?
The InChIKey is WBWDKDUFPGEVTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N4O/c7-4(8)2-12-1-3(9)5(11-12)6(10)13/h1,4H,2,9H2,(H2,10,13).
What are the key properties of 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide?
4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide has a molecular weight of 190.15 g/mol, XLogP of -0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide is sourced from PubChem (CID 107345100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).