C7H9F3N4O2 — CID 107345280
4-amino-1-[2-(trifluoromethoxy)ethyl]pyrazole-3-carboxamide (PubChem CID 107345280) has the molecular formula C7H9F3N4O2 and a molecular weight of 238.17 g/mol. Its IUPAC name is 4-amino-1-[2-(trifluoromethoxy)ethyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-[2-(trifluoromethoxy)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107345280 |
| Molecular Formula | C7H9F3N4O2 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 4-amino-1-[2-(trifluoromethoxy)ethyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CCOC(F)(F)F)cc1N |
| InChI | InChI=1S/C7H9F3N4O2/c8-7(9,10)16-2-1-14-3-4(11)5(13-14)6(12)15/h3H,1-2,11H2,(H2,12,15) |
| InChIKey | MTADHFLWNRGLFF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |