C9H13N3O6S — CID 107345617
4-nitro-1-(2-propan-2-ylsulfonylethyl)pyrazole-3-carboxylic acid (PubChem CID 107345617) has the molecular formula C9H13N3O6S and a molecular weight of 291.29 g/mol. Its IUPAC name is 4-nitro-1-(2-propan-2-ylsulfonylethyl)pyrazole-3-carboxylic acid.
| Compound Name | 4-nitro-1-(2-propan-2-ylsulfonylethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107345617 |
| Molecular Formula | C9H13N3O6S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4-nitro-1-(2-propan-2-ylsulfonylethyl)pyrazole-3-carboxylic acid |
| SMILES | CC(C)S(=O)(=O)CCn1cc([N+](=O)[O-])c(C(=O)O)n1 |
| InChI | InChI=1S/C9H13N3O6S/c1-6(2)19(17,18)4-3-11-5-7(12(15)16)8(10-11)9(13)14/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | WDHNCWPUFUKEQY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|