C13H13BrFN3O — CID 107347742
1-[(3-amino-2-fluorophenyl)methyl]-5-bromo-4,6-dimethylpyrimidin-2-one (PubChem CID 107347742) has the molecular formula C13H13BrFN3O and a molecular weight of 326.17 g/mol. Its IUPAC name is 1-[(3-amino-2-fluorophenyl)methyl]-5-bromo-4,6-dimethylpyrimidin-2-one.
| Compound Name | 1-[(3-amino-2-fluorophenyl)methyl]-5-bromo-4,6-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 107347742 |
| Molecular Formula | C13H13BrFN3O |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 1-[(3-amino-2-fluorophenyl)methyl]-5-bromo-4,6-dimethylpyrimidin-2-one |
| SMILES | Cc1nc(=O)n(Cc2cccc(N)c2F)c(C)c1Br |
| InChI | InChI=1S/C13H13BrFN3O/c1-7-11(14)8(2)18(13(19)17-7)6-9-4-3-5-10(16)12(9)15/h3-5H,6,16H2,1-2H3 |
| InChIKey | YBMKBOXPYZUNLB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|