C19H23N3O2 — CID 10734849
methyl N-(6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizin-13-yl)-N-methylcarbamate (PubChem CID 10734849) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is methyl N-(6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizin-13-yl)-N-methylcarbamate.
| Compound Name | methyl N-(6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizin-13-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 10734849 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | methyl N-(6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizin-13-yl)-N-methylcarbamate |
| SMILES | COC(=O)N(C)c1c2c(nc3ccccc13)CC1CCCCN1C2 |
| InChI | InChI=1S/C19H23N3O2/c1-21(19(23)24-2)18-14-8-3-4-9-16(14)20-17-11-13-7-5-6-10-22(13)12-15(17)18/h3-4,8-9,13H,5-7,10-12H2,1-2H3 |
| InChIKey | DEHGHRHWODHFQW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |