C13H7Cl3FNO3 — CID 107348680
1,3,5-trichloro-2-[(2-fluoro-3-nitrophenyl)methoxy]benzene (PubChem CID 107348680) has the molecular formula C13H7Cl3FNO3 and a molecular weight of 350.56 g/mol. Its IUPAC name is 1,3,5-trichloro-2-[(2-fluoro-3-nitrophenyl)methoxy]benzene.
| Compound Name | 1,3,5-trichloro-2-[(2-fluoro-3-nitrophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 107348680 |
| Molecular Formula | C13H7Cl3FNO3 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 1,3,5-trichloro-2-[(2-fluoro-3-nitrophenyl)methoxy]benzene |
| SMILES | O=[N+]([O-])c1cccc(COc2c(Cl)cc(Cl)cc2Cl)c1F |
| InChI | InChI=1S/C13H7Cl3FNO3/c14-8-4-9(15)13(10(16)5-8)21-6-7-2-1-3-11(12(7)17)18(19)20/h1-5H,6H2 |
| InChIKey | GGNOQPJSNCKVMR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|