C19H38O2Si — CID 10734932
(4R,5R,6R)-2,2-ditert-butyl-5-ethyl-4-methyl-6-(2-methylidenebutyl)-1,3,2-dioxasilinane (PubChem CID 10734932) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (4R,5R,6R)-2,2-ditert-butyl-5-ethyl-4-methyl-6-(2-methylidenebutyl)-1,3,2-dioxasilinane.
| Compound Name | (4R,5R,6R)-2,2-ditert-butyl-5-ethyl-4-methyl-6-(2-methylidenebutyl)-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 10734932 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (4R,5R,6R)-2,2-ditert-butyl-5-ethyl-4-methyl-6-(2-methylidenebutyl)-1,3,2-dioxasilinane |
| SMILES | C=C(CC)C[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@H](C)[C@H]1CC |
| InChI | InChI=1S/C19H38O2Si/c1-11-14(3)13-17-16(12-2)15(4)20-22(21-17,18(5,6)7)19(8,9)10/h15-17H,3,11-13H2,1-2,4-10H3/t15-,16-,17-/m1/s1 |
| InChIKey | GEIJKOKZYVUKSD-BRWVUGGUSA-N |
| XLogP | 6.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|