C21H29NO2 — CID 10734999
(1R,3S,4S,5R,9S,12R)-5,8,8,12-tetramethyl-4-phenyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one (PubChem CID 10734999) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (1R,3S,4S,5R,9S,12R)-5,8,8,12-tetramethyl-4-phenyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one.
| Compound Name | (1R,3S,4S,5R,9S,12R)-5,8,8,12-tetramethyl-4-phenyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one |
|---|---|
| PubChem CID | 10734999 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (1R,3S,4S,5R,9S,12R)-5,8,8,12-tetramethyl-4-phenyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@H](c3ccccc3)[C@@H](C)C(=O)N1C2(C)C |
| InChI | InChI=1S/C21H29NO2/c1-13-10-11-16-17(12-13)24-20-18(15-8-6-5-7-9-15)14(2)19(23)22(20)21(16,3)4/h5-9,13-14,16-18,20H,10-12H2,1-4H3/t13-,14-,16-,17-,18+,20+/m1/s1 |
| InChIKey | AMMBGFXMVFQJRX-BTZOVSBKSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |