C14H21FN2O2 — CID 107350057
3-[(2-fluoro-3-nitrophenyl)methyl]-N,4-dimethylpentan-2-amine (PubChem CID 107350057) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 3-[(2-fluoro-3-nitrophenyl)methyl]-N,4-dimethylpentan-2-amine.
| Compound Name | 3-[(2-fluoro-3-nitrophenyl)methyl]-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 107350057 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-[(2-fluoro-3-nitrophenyl)methyl]-N,4-dimethylpentan-2-amine |
| SMILES | CNC(C)C(Cc1cccc([N+](=O)[O-])c1F)C(C)C |
| InChI | InChI=1S/C14H21FN2O2/c1-9(2)12(10(3)16-4)8-11-6-5-7-13(14(11)15)17(18)19/h5-7,9-10,12,16H,8H2,1-4H3 |
| InChIKey | JOVGXSAVYOAVKQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|