C14H21N3O3 — CID 107351068
2-nitro-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]aniline (PubChem CID 107351068) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-nitro-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]aniline.
| Compound Name | 2-nitro-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 107351068 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-nitro-6-[(2,2,6-trimethylmorpholin-4-yl)methyl]aniline |
| SMILES | CC1CN(Cc2cccc([N+](=O)[O-])c2N)CC(C)(C)O1 |
| InChI | InChI=1S/C14H21N3O3/c1-10-7-16(9-14(2,3)20-10)8-11-5-4-6-12(13(11)15)17(18)19/h4-6,10H,7-9,15H2,1-3H3 |
| InChIKey | KBUPNTMSFVGEQN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|