C14H22N4O3 — CID 107351216
2-[(2-amino-3-nitrophenyl)methyl-propylamino]-N,N-dimethylacetamide (PubChem CID 107351216) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[(2-amino-3-nitrophenyl)methyl-propylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(2-amino-3-nitrophenyl)methyl-propylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 107351216 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[(2-amino-3-nitrophenyl)methyl-propylamino]-N,N-dimethylacetamide |
| SMILES | CCCN(CC(=O)N(C)C)Cc1cccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C14H22N4O3/c1-4-8-17(10-13(19)16(2)3)9-11-6-5-7-12(14(11)15)18(20)21/h5-7H,4,8-10,15H2,1-3H3 |
| InChIKey | NXRVFSGFIUQEBU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|