C10H12N6O2S — CID 107353512
[2-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6-nitrophenyl]hydrazine (PubChem CID 107353512) has the molecular formula C10H12N6O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is [2-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6-nitrophenyl]hydrazine.
| Compound Name | [2-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 107353512 |
| Molecular Formula | C10H12N6O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | [2-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-6-nitrophenyl]hydrazine |
| SMILES | Cn1ncnc1SCc1cccc([N+](=O)[O-])c1NN |
| InChI | InChI=1S/C10H12N6O2S/c1-15-10(12-6-13-15)19-5-7-3-2-4-8(16(17)18)9(7)14-11/h2-4,6,14H,5,11H2,1H3 |
| InChIKey | SFYIKSOOROPCEQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|