About tri(propan-2-yl)silyl pent-4-enoate
tri(propan-2-yl)silyl pent-4-enoate (PubChem CID 10735566) has the molecular formula C14H28O2Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is tri(propan-2-yl)silyl pent-4-enoate.
Molecular Properties
| Compound Name | tri(propan-2-yl)silyl pent-4-enoate |
| PubChem CID | 10735566 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | tri(propan-2-yl)silyl pent-4-enoate |
| SMILES | C=CCCC(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-8-9-10-14(15)16-17(11(2)3,12(4)5)13(6)7/h8,11-13H,1,9-10H2,2-7H3 |
| InChIKey | WBIJBAGXWLHGNA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)silyl pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)silyl pent-4-enoate?
The IUPAC name of tri(propan-2-yl)silyl pent-4-enoate (CID 10735566) is tri(propan-2-yl)silyl pent-4-enoate.
What is the SMILES notation for tri(propan-2-yl)silyl pent-4-enoate?
The canonical SMILES for tri(propan-2-yl)silyl pent-4-enoate is C=CCCC(=O)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of tri(propan-2-yl)silyl pent-4-enoate?
The InChIKey is WBIJBAGXWLHGNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2Si/c1-8-9-10-14(15)16-17(11(2)3,12(4)5)13(6)7/h8,11-13H,1,9-10H2,2-7H3.
What are the key properties of tri(propan-2-yl)silyl pent-4-enoate?
tri(propan-2-yl)silyl pent-4-enoate has a molecular weight of 256.46 g/mol, XLogP of 4.67, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)silyl pent-4-enoate is sourced from PubChem (CID 10735566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).