C14H20N4O2 — CID 107356107
N-(2-amino-2-oxoethyl)-N-propan-2-yl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide (PubChem CID 107356107) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-propan-2-yl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-propan-2-yl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 107356107 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-propan-2-yl-1,2,3,4-tetrahydroquinoxaline-2-carboxamide |
| SMILES | CC(C)N(CC(N)=O)C(=O)C1CNc2ccccc2N1 |
| InChI | InChI=1S/C14H20N4O2/c1-9(2)18(8-13(15)19)14(20)12-7-16-10-5-3-4-6-11(10)17-12/h3-6,9,12,16-17H,7-8H2,1-2H3,(H2,15,19) |
| InChIKey | HBABAAMCTDGSTR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|