C9H3ClF6N2OS — CID 10735637
7-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 10735637) has the molecular formula C9H3ClF6N2OS and a molecular weight of 336.64 g/mol. Its IUPAC name is 7-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 10735637 |
| Molecular Formula | C9H3ClF6N2OS |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 7-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)C(F)(F)Cl)nc2sccn12 |
| InChI | InChI=1S/C9H3ClF6N2OS/c10-9(15,16)8(13,14)7(11,12)4-3-5(19)18-1-2-20-6(18)17-4/h1-3H |
| InChIKey | HWIALWFCXFXLPI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|