C15H11Cl2N3 — CID 107356865
(3,4-dichlorophenyl)-quinoxalin-2-ylmethanamine (PubChem CID 107356865) has the molecular formula C15H11Cl2N3 and a molecular weight of 304.18 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-quinoxalin-2-ylmethanamine.
| Compound Name | (3,4-dichlorophenyl)-quinoxalin-2-ylmethanamine |
|---|---|
| PubChem CID | 107356865 |
| Molecular Formula | C15H11Cl2N3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (3,4-dichlorophenyl)-quinoxalin-2-ylmethanamine |
| SMILES | NC(c1ccc(Cl)c(Cl)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C15H11Cl2N3/c16-10-6-5-9(7-11(10)17)15(18)14-8-19-12-3-1-2-4-13(12)20-14/h1-8,15H,18H2 |
| InChIKey | QQDIGSNQJPCRSH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |