C18H19N3 — CID 107356945
1-(3,5-dimethylphenyl)-N-methyl-1-quinoxalin-2-ylmethanamine (PubChem CID 107356945) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-methyl-1-quinoxalin-2-ylmethanamine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-methyl-1-quinoxalin-2-ylmethanamine |
|---|---|
| PubChem CID | 107356945 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-methyl-1-quinoxalin-2-ylmethanamine |
| SMILES | CNC(c1cc(C)cc(C)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C18H19N3/c1-12-8-13(2)10-14(9-12)18(19-3)17-11-20-15-6-4-5-7-16(15)21-17/h4-11,18-19H,1-3H3 |
| InChIKey | JDPLUUWMHVFYPV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |