C19H34O3Si — CID 10735779
(1aR,2aR,6S,6aS,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4,4,6a-trimethyl-2a,3,5,6,7,7a-hexahydro-1aH-naphtho[2,3-b]oxiren-2-one (PubChem CID 10735779) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is (1aR,2aR,6S,6aS,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4,4,6a-trimethyl-2a,3,5,6,7,7a-hexahydro-1aH-naphtho[2,3-b]oxiren-2-one.
| Compound Name | (1aR,2aR,6S,6aS,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4,4,6a-trimethyl-2a,3,5,6,7,7a-hexahydro-1aH-naphtho[2,3-b]oxiren-2-one |
|---|---|
| PubChem CID | 10735779 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | (1aR,2aR,6S,6aS,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4,4,6a-trimethyl-2a,3,5,6,7,7a-hexahydro-1aH-naphtho[2,3-b]oxiren-2-one |
| SMILES | CC1(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)C[C@H]3O[C@H]3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C19H34O3Si/c1-17(2,3)23(7,8)22-14-11-18(4,5)9-12-15(20)16-13(21-16)10-19(12,14)6/h12-14,16H,9-11H2,1-8H3/t12-,13+,14-,16+,19-/m0/s1 |
| InChIKey | XQTCEPRDORBCMV-XVNUXHDISA-N |
| XLogP | 4.56 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|