C16H21NO7 — CID 10735805
(4S,5S,6Z,11S)-6-ethylidene-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one (PubChem CID 10735805) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is (4S,5S,6Z,11S)-6-ethylidene-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one.
| Compound Name | (4S,5S,6Z,11S)-6-ethylidene-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one |
|---|---|
| PubChem CID | 10735805 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (4S,5S,6Z,11S)-6-ethylidene-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one |
| SMILES | C/C=C1/C2=CCCN3C(=O)O[C@H]([C@H]1O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O)[C@H]23 |
| InChI | InChI=1S/C16H21NO7/c1-2-7-8-4-3-5-17-10(8)14(24-16(17)21)13(7)23-15-12(20)11(19)9(18)6-22-15/h2,4,9-15,18-20H,3,5-6H2,1H3/b7-2-/t9-,10+,11+,12-,13+,14+,15+/m1/s1 |
| InChIKey | ZYBDXIUZGXXAHC-BITYOMICSA-N |
| XLogP | -0.71 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |