C13H15F4N3O — CID 107358771
2-fluoro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide (PubChem CID 107358771) has the molecular formula C13H15F4N3O and a molecular weight of 305.27 g/mol. Its IUPAC name is 2-fluoro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107358771 |
| Molecular Formula | C13H15F4N3O |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-fluoro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCN(CC(F)(F)F)C1)c1cccnc1F |
| InChI | InChI=1S/C13H15F4N3O/c14-11-10(2-1-4-18-11)12(21)19-6-9-3-5-20(7-9)8-13(15,16)17/h1-2,4,9H,3,5-8H2,(H,19,21) |
| InChIKey | RKUOAQDQYAUBBK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|