C13H13FN2OS — CID 107358824
2-fluoro-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide (PubChem CID 107358824) has the molecular formula C13H13FN2OS and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-fluoro-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107358824 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-fluoro-N-(1-thiophen-2-ylpropan-2-yl)pyridine-3-carboxamide |
| SMILES | CC(Cc1cccs1)NC(=O)c1cccnc1F |
| InChI | InChI=1S/C13H13FN2OS/c1-9(8-10-4-3-7-18-10)16-13(17)11-5-2-6-15-12(11)14/h2-7,9H,8H2,1H3,(H,16,17) |
| InChIKey | KZJMJDHZCMQIGK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|