C6H4ClF3OS — CID 107359618
(1R)-1-(3-chlorothiophen-2-yl)-2,2,2-trifluoroethanol (PubChem CID 107359618) has the molecular formula C6H4ClF3OS and a molecular weight of 216.61 g/mol. Its IUPAC name is (1R)-1-(3-chlorothiophen-2-yl)-2,2,2-trifluoroethanol.
| Compound Name | (1R)-1-(3-chlorothiophen-2-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 107359618 |
| Molecular Formula | C6H4ClF3OS |
| Molecular Weight | 216.61 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | (1R)-1-(3-chlorothiophen-2-yl)-2,2,2-trifluoroethanol |
| SMILES | O[C@@H](c1sccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C6H4ClF3OS/c7-3-1-2-12-4(3)5(11)6(8,9)10/h1-2,5,11H/t5-/m0/s1 |
| InChIKey | BFBULSINCUDGAG-YFKPBYRVSA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |