C11H16ClNS2 — CID 107360038
N-[(3-chlorothiophen-2-yl)-(thiolan-2-yl)methyl]ethanamine (PubChem CID 107360038) has the molecular formula C11H16ClNS2 and a molecular weight of 261.84 g/mol. Its IUPAC name is N-[(3-chlorothiophen-2-yl)-(thiolan-2-yl)methyl]ethanamine.
| Compound Name | N-[(3-chlorothiophen-2-yl)-(thiolan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107360038 |
| Molecular Formula | C11H16ClNS2 |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-[(3-chlorothiophen-2-yl)-(thiolan-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1sccc1Cl)C1CCCS1 |
| InChI | InChI=1S/C11H16ClNS2/c1-2-13-10(9-4-3-6-14-9)11-8(12)5-7-15-11/h5,7,9-10,13H,2-4,6H2,1H3 |
| InChIKey | SSHIGNSNFFNQGJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |