C22H32O3 — CID 10736255
[(1S,4R,4aR,4bR,8aS,10aR)-2-ethenyl-1,4b,8,8-tetramethyl-7-oxo-4,4a,5,6,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate (PubChem CID 10736255) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(1S,4R,4aR,4bR,8aS,10aR)-2-ethenyl-1,4b,8,8-tetramethyl-7-oxo-4,4a,5,6,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate.
| Compound Name | [(1S,4R,4aR,4bR,8aS,10aR)-2-ethenyl-1,4b,8,8-tetramethyl-7-oxo-4,4a,5,6,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 10736255 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(1S,4R,4aR,4bR,8aS,10aR)-2-ethenyl-1,4b,8,8-tetramethyl-7-oxo-4,4a,5,6,8a,9,10,10a-octahydro-1H-phenanthren-4-yl] acetate |
| SMILES | C=CC1=C[C@@H](OC(C)=O)[C@@H]2[C@H](CC[C@@H]3C(C)(C)C(=O)CC[C@@]23C)[C@@H]1C |
| InChI | InChI=1S/C22H32O3/c1-7-15-12-17(25-14(3)23)20-16(13(15)2)8-9-18-21(4,5)19(24)10-11-22(18,20)6/h7,12-13,16-18,20H,1,8-11H2,2-6H3/t13-,16-,17-,18-,20+,22-/m1/s1 |
| InChIKey | IYAJNZPPTQEEST-ZJLVHUEYSA-N |
| XLogP | 4.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |