C13H16N4O3 — CID 107362610
3-[3-(benzimidazol-1-yl)propanoylamino]-2-hydroxypropanamide (PubChem CID 107362610) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-[3-(benzimidazol-1-yl)propanoylamino]-2-hydroxypropanamide.
| Compound Name | 3-[3-(benzimidazol-1-yl)propanoylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 107362610 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-[3-(benzimidazol-1-yl)propanoylamino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC(=O)CCn1cnc2ccccc21 |
| InChI | InChI=1S/C13H16N4O3/c14-13(20)11(18)7-15-12(19)5-6-17-8-16-9-3-1-2-4-10(9)17/h1-4,8,11,18H,5-7H2,(H2,14,20)(H,15,19) |
| InChIKey | MROOWPXSDCZOEO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |